C26H28N6O2 — CID 59473312
(3S)-1-[4-[[6-(3,4-dihydro-2H-1,4-benzoxazin-7-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpiperidin-3-ol (PubChem CID 59473312) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (3S)-1-[4-[[6-(3,4-dihydro-2H-1,4-benzoxazin-7-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpiperidin-3-ol.
| Compound Name | (3S)-1-[4-[[6-(3,4-dihydro-2H-1,4-benzoxazin-7-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 59473312 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3S)-1-[4-[[6-(3,4-dihydro-2H-1,4-benzoxazin-7-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]-3-methylpiperidin-3-ol |
| SMILES | C[C@]1(O)CCCN(c2ccc(Nc3nc(-c4ccc5c(c4)OCCN5)cn4ccnc34)cc2)C1 |
| InChI | InChI=1S/C26H28N6O2/c1-26(33)9-2-12-32(17-26)20-6-4-19(5-7-20)29-24-25-28-10-13-31(25)16-22(30-24)18-3-8-21-23(15-18)34-14-11-27-21/h3-8,10,13,15-16,27,33H,2,9,11-12,14,17H2,1H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | XEAJQKWPBJMMJI-SANMLTNESA-N |
| XLogP | 4.30 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|