C24H23N7O — CID 59473555
6-(1H-indazol-6-yl)-N-[4-(1,4-oxazepan-4-yl)phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 59473555) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is 6-(1H-indazol-6-yl)-N-[4-(1,4-oxazepan-4-yl)phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(1H-indazol-6-yl)-N-[4-(1,4-oxazepan-4-yl)phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 59473555 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 6-(1H-indazol-6-yl)-N-[4-(1,4-oxazepan-4-yl)phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1cn2cc(-c3ccc4cn[nH]c4c3)nc(Nc3ccc(N4CCCOCC4)cc3)c2n1 |
| InChI | InChI=1S/C24H23N7O/c1-9-30(11-13-32-12-1)20-6-4-19(5-7-20)27-23-24-25-8-10-31(24)16-22(28-23)17-2-3-18-15-26-29-21(18)14-17/h2-8,10,14-16H,1,9,11-13H2,(H,26,29)(H,27,28) |
| InChIKey | MUBBHSMQBJBMMG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|