C27H30N6O — CID 59473588
6-(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 59473588) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 6-(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 59473588 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 6-(2-ethyl-3,4-dihydro-1H-isoquinolin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCN1CCc2ccc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)cc2C1 |
| InChI | InChI=1S/C27H30N6O/c1-2-31-11-9-20-3-4-21(17-22(20)18-31)25-19-33-12-10-28-27(33)26(30-25)29-23-5-7-24(8-6-23)32-13-15-34-16-14-32/h3-8,10,12,17,19H,2,9,11,13-16,18H2,1H3,(H,29,30) |
| InChIKey | HRZWFLHHARKBOU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|