C27H28N6O2 — CID 59473602
1-[6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 59473602) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-[6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 1-[6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 59473602 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-[6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)ccc2C1 |
| InChI | InChI=1S/C27H28N6O2/c1-19(34)32-10-8-20-16-21(2-3-22(20)17-32)25-18-33-11-9-28-27(33)26(30-25)29-23-4-6-24(7-5-23)31-12-14-35-15-13-31/h2-7,9,11,16,18H,8,10,12-15,17H2,1H3,(H,29,30) |
| InChIKey | ZXUMVWPLWFZYJD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|