About 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid
2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid (PubChem CID 59473692) has the molecular formula C21H16ClN3O3
and a molecular weight of 393.83 g/mol. Its IUPAC name is 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid |
| PubChem CID | 59473692 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccc2ccc(N3CCn4c(c(Cl)c5ccccc54)C3=O)cc21 |
| InChI | InChI=1S/C21H16ClN3O3/c22-19-15-3-1-2-4-16(15)25-10-9-24(21(28)20(19)25)14-6-5-13-7-8-23(12-18(26)27)17(13)11-14/h1-8,11H,9-10,12H2,(H,26,27) |
| InChIKey | MZCSYSAHQLYVIV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid?
The IUPAC name of 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid (CID 59473692) is 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid.
What is the SMILES notation for 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid?
The canonical SMILES for 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid is O=C(O)Cn1ccc2ccc(N3CCn4c(c(Cl)c5ccccc54)C3=O)cc21.
What is the InChIKey of 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid?
The InChIKey is MZCSYSAHQLYVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN3O3/c22-19-15-3-1-2-4-16(15)25-10-9-24(21(28)20(19)25)14-6-5-13-7-8-23(12-18(26)27)17(13)11-14/h1-8,11H,9-10,12H2,(H,26,27).
What are the key properties of 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid?
2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid has a molecular weight of 393.83 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(10-chloro-1-oxo-3,4-dihydropyrazino[1,2-a]indol-2-yl)indol-1-yl]acetic acid is sourced from PubChem (CID 59473692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).