C9H13F3N2O2S — CID 59473895
(2S)-2-[2-oxo-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-3-yl]butanamide (PubChem CID 59473895) has the molecular formula C9H13F3N2O2S and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S)-2-[2-oxo-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | (2S)-2-[2-oxo-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 59473895 |
| Molecular Formula | C9H13F3N2O2S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2S)-2-[2-oxo-5-(2,2,2-trifluoroethyl)-1,3-thiazolidin-3-yl]butanamide |
| SMILES | CC[C@@H](C(N)=O)N1CC(CC(F)(F)F)SC1=O |
| InChI | InChI=1S/C9H13F3N2O2S/c1-2-6(7(13)15)14-4-5(17-8(14)16)3-9(10,11)12/h5-6H,2-4H2,1H3,(H2,13,15)/t5?,6-/m0/s1 |
| InChIKey | GYGZIDNKFLKQPM-GDVGLLTNSA-N |
| XLogP | 1.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|