C21H22FN7O — CID 59474172
3-[(5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 59474172) has the molecular formula C21H22FN7O and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-[(5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | 3-[(5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59474172 |
| Molecular Formula | C21H22FN7O |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 3-[(5-fluoropyrimidin-4-yl)amino]-6,6-dimethyl-N-[(1S,2R)-2-phenylcyclopropyl]-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CC1(C)c2[nH]nc(Nc3ncncc3F)c2CN1C(=O)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22FN7O/c1-21(2)17-14(18(28-27-17)26-19-15(22)9-23-11-24-19)10-29(21)20(30)25-16-8-13(16)12-6-4-3-5-7-12/h3-7,9,11,13,16H,8,10H2,1-2H3,(H,25,30)(H2,23,24,26,27,28)/t13-,16+/m1/s1 |
| InChIKey | BRQLCBZGVRLZMJ-CJNGLKHVSA-N |
| XLogP | 3.40 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |