C21H20F4N2O3 — CID 59475050
6-[[(E)-2-(4-fluorophenyl)-3-(2,4,6-trifluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide (PubChem CID 59475050) has the molecular formula C21H20F4N2O3 and a molecular weight of 424.39 g/mol. Its IUPAC name is 6-[[(E)-2-(4-fluorophenyl)-3-(2,4,6-trifluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[(E)-2-(4-fluorophenyl)-3-(2,4,6-trifluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 59475050 |
| Molecular Formula | C21H20F4N2O3 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 6-[[(E)-2-(4-fluorophenyl)-3-(2,4,6-trifluorophenyl)prop-2-enoyl]amino]-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCNC(=O)/C(=C/c1c(F)cc(F)cc1F)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C21H20F4N2O3/c22-14-7-5-13(6-8-14)16(12-17-18(24)10-15(23)11-19(17)25)21(29)26-9-3-1-2-4-20(28)27-30/h5-8,10-12,30H,1-4,9H2,(H,26,29)(H,27,28)/b16-12+ |
| InChIKey | NDVGLZIKCDJIEM-FOWTUZBSSA-N |
| XLogP | 3.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|