About 1-(4,5-dichlorothiophen-3-yl)propan-2-amine
1-(4,5-dichlorothiophen-3-yl)propan-2-amine (PubChem CID 59475094) has the molecular formula C7H9Cl2NS
and a molecular weight of 210.13 g/mol. Its IUPAC name is 1-(4,5-dichlorothiophen-3-yl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(4,5-dichlorothiophen-3-yl)propan-2-amine |
| PubChem CID | 59475094 |
| Molecular Formula | C7H9Cl2NS |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 1-(4,5-dichlorothiophen-3-yl)propan-2-amine |
| SMILES | CC(N)Cc1csc(Cl)c1Cl |
| InChI | InChI=1S/C7H9Cl2NS/c1-4(10)2-5-3-11-7(9)6(5)8/h3-4H,2,10H2,1H3 |
| InChIKey | ZLFSPIXQEATAJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,5-dichlorothiophen-3-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dichlorothiophen-3-yl)propan-2-amine?
The IUPAC name of 1-(4,5-dichlorothiophen-3-yl)propan-2-amine (CID 59475094) is 1-(4,5-dichlorothiophen-3-yl)propan-2-amine.
What is the SMILES notation for 1-(4,5-dichlorothiophen-3-yl)propan-2-amine?
The canonical SMILES for 1-(4,5-dichlorothiophen-3-yl)propan-2-amine is CC(N)Cc1csc(Cl)c1Cl.
What is the InChIKey of 1-(4,5-dichlorothiophen-3-yl)propan-2-amine?
The InChIKey is ZLFSPIXQEATAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2NS/c1-4(10)2-5-3-11-7(9)6(5)8/h3-4H,2,10H2,1H3.
What are the key properties of 1-(4,5-dichlorothiophen-3-yl)propan-2-amine?
1-(4,5-dichlorothiophen-3-yl)propan-2-amine has a molecular weight of 210.13 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dichlorothiophen-3-yl)propan-2-amine is sourced from PubChem (CID 59475094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).