C18H21NO7S — CID 59475115
methyl 3-[(6-ethylsulfonyl-3-pyridinyl)oxy]-5-[(2S)-1-hydroxypropan-2-yl]oxybenzoate (PubChem CID 59475115) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is methyl 3-[(6-ethylsulfonyl-3-pyridinyl)oxy]-5-[(2S)-1-hydroxypropan-2-yl]oxybenzoate.
| Compound Name | methyl 3-[(6-ethylsulfonyl-3-pyridinyl)oxy]-5-[(2S)-1-hydroxypropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 59475115 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 3-[(6-ethylsulfonyl-3-pyridinyl)oxy]-5-[(2S)-1-hydroxypropan-2-yl]oxybenzoate |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc(O[C@@H](C)CO)cc(C(=O)OC)c2)cn1 |
| InChI | InChI=1S/C18H21NO7S/c1-4-27(22,23)17-6-5-14(10-19-17)26-16-8-13(18(21)24-3)7-15(9-16)25-12(2)11-20/h5-10,12,20H,4,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | CDWXYJGDOZJXSP-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |