C64H44O4 — CID 59475308
3,4,18,19-tetraphenylheptacyclo[26.2.2.26,9.213,16.221,24.12,5.117,20]tetraconta-1(30),2,4,6(39),7,9(38),13(37),14,16(36),17,19,21,23,28,31,33-hexadecaene-11,26,35,40-tetrone (PubChem CID 59475308) has the molecular formula C64H44O4 and a molecular weight of 877.05 g/mol. Its IUPAC name is 3,4,18,19-tetraphenylheptacyclo[26.2.2.26,9.213,16.221,24.12,5.117,20]tetraconta-1(30),2,4,6(39),7,9(38),13(37),14,16(36),17,19,21,23,28,31,33-hexadecaene-11,26,35,40-tetrone.
| Compound Name | 3,4,18,19-tetraphenylheptacyclo[26.2.2.26,9.213,16.221,24.12,5.117,20]tetraconta-1(30),2,4,6(39),7,9(38),13(37),14,16(36),17,19,21,23,28,31,33-hexadecaene-11,26,35,40-tetrone |
|---|---|
| PubChem CID | 59475308 |
| Molecular Formula | C64H44O4 |
| Molecular Weight | 877.05 g/mol |
| Exact Mass | 876.32 |
| IUPAC Name | 3,4,18,19-tetraphenylheptacyclo[26.2.2.26,9.213,16.221,24.12,5.117,20]tetraconta-1(30),2,4,6(39),7,9(38),13(37),14,16(36),17,19,21,23,28,31,33-hexadecaene-11,26,35,40-tetrone |
| SMILES | O=C1Cc2ccc(cc2)C2=C(c3ccccc3)C(c3ccccc3)=C(C2=O)c2ccc(cc2)CC(=O)Cc2ccc(cc2)C2=C(c3ccccc3)C(c3ccccc3)=C(C2=O)c2ccc(cc2)C1 |
| InChI | InChI=1S/C64H44O4/c65-53-37-41-21-29-49(30-22-41)59-55(45-13-5-1-6-14-45)56(46-15-7-2-8-16-46)60(63(59)67)50-31-23-42(24-32-50)38-54(66)40-44-27-35-52(36-28-44)62-58(48-19-11-4-12-20-48)57(47-17-9-3-10-18-47)61(64(62)68)51-33-25-43(39-53)26-34-51/h1-36H,37-40H2 |
| InChIKey | AKTFQNAEAUQBJG-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.05 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|