C21H26N8O2 — CID 59475777
2-[[3-[[4-[2-(3-aminopropylamino)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]methyl-methylamino]acetic acid (PubChem CID 59475777) has the molecular formula C21H26N8O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[[3-[[4-[2-(3-aminopropylamino)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[3-[[4-[2-(3-aminopropylamino)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 59475777 |
| Molecular Formula | C21H26N8O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[[3-[[4-[2-(3-aminopropylamino)-4-pyridinyl]-1,3,5-triazin-2-yl]amino]phenyl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1cccc(Nc2ncnc(-c3ccnc(NCCCN)c3)n2)c1 |
| InChI | InChI=1S/C21H26N8O2/c1-29(13-19(30)31)12-15-4-2-5-17(10-15)27-21-26-14-25-20(28-21)16-6-9-24-18(11-16)23-8-3-7-22/h2,4-6,9-11,14H,3,7-8,12-13,22H2,1H3,(H,23,24)(H,30,31)(H,25,26,27,28) |
| InChIKey | DQYLRCAVXVNNQE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|