About 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide
2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide (PubChem CID 59475908) has the molecular formula C21H26ClN5OS
and a molecular weight of 431.99 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide |
| PubChem CID | 59475908 |
| Molecular Formula | C21H26ClN5OS |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide |
| SMILES | O=S1CCc2nc(N3CCN(c4ccc(Cl)cc4)CC3)nc(N3CCCCC3)c21 |
| InChI | InChI=1S/C21H26ClN5OS/c22-16-4-6-17(7-5-16)25-11-13-27(14-12-25)21-23-18-8-15-29(28)19(18)20(24-21)26-9-2-1-3-10-26/h4-7H,1-3,8-15H2 |
| InChIKey | LGTBSCUNDLZRRO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The IUPAC name of 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide (CID 59475908) is 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide.
What is the SMILES notation for 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The canonical SMILES for 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide is O=S1CCc2nc(N3CCN(c4ccc(Cl)cc4)CC3)nc(N3CCCCC3)c21.
What is the InChIKey of 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
The InChIKey is LGTBSCUNDLZRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClN5OS/c22-16-4-6-17(7-5-16)25-11-13-27(14-12-25)21-23-18-8-15-29(28)19(18)20(24-21)26-9-2-1-3-10-26/h4-7H,1-3,8-15H2.
What are the key properties of 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide?
2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide has a molecular weight of 431.99 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)piperazin-1-yl]-4-piperidin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine 5-oxide is sourced from PubChem (CID 59475908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).