About 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one
10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one (PubChem CID 59475980) has the molecular formula C25H46O6
and a molecular weight of 442.64 g/mol. Its IUPAC name is 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one.
Molecular Properties
| Compound Name | 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one |
| PubChem CID | 59475980 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one |
| SMILES | CCCCCC1OC(C(CCCCCCCC(C)=O)OCC2COC(C)(C)O2)CC1O |
| InChI | InChI=1S/C25H46O6/c1-5-6-10-14-22-21(27)16-24(30-22)23(15-12-9-7-8-11-13-19(2)26)28-17-20-18-29-25(3,4)31-20/h20-24,27H,5-18H2,1-4H3 |
| InChIKey | AGJZVGHRPMCKSB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one?
The IUPAC name of 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one (CID 59475980) is 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one.
What is the SMILES notation for 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one?
The canonical SMILES for 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one is CCCCCC1OC(C(CCCCCCCC(C)=O)OCC2COC(C)(C)O2)CC1O.
What is the InChIKey of 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one?
The InChIKey is AGJZVGHRPMCKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46O6/c1-5-6-10-14-22-21(27)16-24(30-22)23(15-12-9-7-8-11-13-19(2)26)28-17-20-18-29-25(3,4)31-20/h20-24,27H,5-18H2,1-4H3.
What are the key properties of 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one?
10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one has a molecular weight of 442.64 g/mol, XLogP of 4.94, 16 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-10-(4-hydroxy-5-pentyloxolan-2-yl)decan-2-one is sourced from PubChem (CID 59475980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).