About pyrazolo[1,5-a]pyridine-5-carboxamide
pyrazolo[1,5-a]pyridine-5-carboxamide (PubChem CID 59476214) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyridine-5-carboxamide |
| PubChem CID | 59476214 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | pyrazolo[1,5-a]pyridine-5-carboxamide |
| SMILES | NC(=O)c1ccn2nccc2c1 |
| InChI | InChI=1S/C8H7N3O/c9-8(12)6-2-4-11-7(5-6)1-3-10-11/h1-5H,(H2,9,12) |
| InChIKey | XCDRZFXDJGFXBD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[1,5-a]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyridine-5-carboxamide?
The IUPAC name of pyrazolo[1,5-a]pyridine-5-carboxamide (CID 59476214) is pyrazolo[1,5-a]pyridine-5-carboxamide.
What is the SMILES notation for pyrazolo[1,5-a]pyridine-5-carboxamide?
The canonical SMILES for pyrazolo[1,5-a]pyridine-5-carboxamide is NC(=O)c1ccn2nccc2c1.
What is the InChIKey of pyrazolo[1,5-a]pyridine-5-carboxamide?
The InChIKey is XCDRZFXDJGFXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-8(12)6-2-4-11-7(5-6)1-3-10-11/h1-5H,(H2,9,12).
What are the key properties of pyrazolo[1,5-a]pyridine-5-carboxamide?
pyrazolo[1,5-a]pyridine-5-carboxamide has a molecular weight of 161.16 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyridine-5-carboxamide is sourced from PubChem (CID 59476214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).