About 2-pyrazolo[1,5-a]pyridin-5-ylethanol
2-pyrazolo[1,5-a]pyridin-5-ylethanol (PubChem CID 59476221) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-pyrazolo[1,5-a]pyridin-5-ylethanol.
Molecular Properties
| Compound Name | 2-pyrazolo[1,5-a]pyridin-5-ylethanol |
| PubChem CID | 59476221 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-pyrazolo[1,5-a]pyridin-5-ylethanol |
| SMILES | OCCc1ccn2nccc2c1 |
| InChI | InChI=1S/C9H10N2O/c12-6-3-8-2-5-11-9(7-8)1-4-10-11/h1-2,4-5,7,12H,3,6H2 |
| InChIKey | CCTNNQNQZRIUJR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazolo[1,5-a]pyridin-5-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazolo[1,5-a]pyridin-5-ylethanol?
The IUPAC name of 2-pyrazolo[1,5-a]pyridin-5-ylethanol (CID 59476221) is 2-pyrazolo[1,5-a]pyridin-5-ylethanol.
What is the SMILES notation for 2-pyrazolo[1,5-a]pyridin-5-ylethanol?
The canonical SMILES for 2-pyrazolo[1,5-a]pyridin-5-ylethanol is OCCc1ccn2nccc2c1.
What is the InChIKey of 2-pyrazolo[1,5-a]pyridin-5-ylethanol?
The InChIKey is CCTNNQNQZRIUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c12-6-3-8-2-5-11-9(7-8)1-4-10-11/h1-2,4-5,7,12H,3,6H2.
What are the key properties of 2-pyrazolo[1,5-a]pyridin-5-ylethanol?
2-pyrazolo[1,5-a]pyridin-5-ylethanol has a molecular weight of 162.19 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazolo[1,5-a]pyridin-5-ylethanol is sourced from PubChem (CID 59476221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).