C16H28 — CID 59476458
1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)cyclohexane (PubChem CID 59476458) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)cyclohexane.
| Compound Name | 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)cyclohexane |
|---|---|
| PubChem CID | 59476458 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1-tert-butyl-4-(3,3-dimethylbut-1-ynyl)cyclohexane |
| SMILES | CC(C)(C)C#CC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28/c1-15(2,3)12-11-13-7-9-14(10-8-13)16(4,5)6/h13-14H,7-10H2,1-6H3 |
| InChIKey | OWALPCCTJVNIDL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|