About 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one
3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one (PubChem CID 59477486) has the molecular formula C12H13F2NO2
and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one |
| PubChem CID | 59477486 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one |
| SMILES | CC(C)(C)C1(O)C(=O)Nc2c1ccc(F)c2F |
| InChI | InChI=1S/C12H13F2NO2/c1-11(2,3)12(17)6-4-5-7(13)8(14)9(6)15-10(12)16/h4-5,17H,1-3H3,(H,15,16) |
| InChIKey | MAOHCQKCCLQJBQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one?
The IUPAC name of 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one (CID 59477486) is 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one.
What is the SMILES notation for 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one?
The canonical SMILES for 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one is CC(C)(C)C1(O)C(=O)Nc2c1ccc(F)c2F.
What is the InChIKey of 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one?
The InChIKey is MAOHCQKCCLQJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c1-11(2,3)12(17)6-4-5-7(13)8(14)9(6)15-10(12)16/h4-5,17H,1-3H3,(H,15,16).
What are the key properties of 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one?
3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one has a molecular weight of 241.24 g/mol, XLogP of 2.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6,7-difluoro-3-hydroxy-1H-indol-2-one is sourced from PubChem (CID 59477486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).