About 1-ethynyladamantane
1-ethynyladamantane (PubChem CID 594781) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-ethynyladamantane.
Molecular Properties
| Compound Name | 1-ethynyladamantane |
| PubChem CID | 594781 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-ethynyladamantane |
| SMILES | C#CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H16/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12/h1,9-11H,3-8H2 |
| InChIKey | KJNCIYYNPLWHDW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyladamantane?
The IUPAC name of 1-ethynyladamantane (CID 594781) is 1-ethynyladamantane.
What is the SMILES notation for 1-ethynyladamantane?
The canonical SMILES for 1-ethynyladamantane is C#CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-ethynyladamantane?
The InChIKey is KJNCIYYNPLWHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-2-12-6-9-3-10(7-12)5-11(4-9)8-12/h1,9-11H,3-8H2.
What are the key properties of 1-ethynyladamantane?
1-ethynyladamantane has a molecular weight of 160.26 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyladamantane is sourced from PubChem (CID 594781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).