C25H27Cl2N3O7S — CID 59478228
ethyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate (PubChem CID 59478228) has the molecular formula C25H27Cl2N3O7S and a molecular weight of 584.48 g/mol. Its IUPAC name is ethyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate.
| Compound Name | ethyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 59478228 |
| Molecular Formula | C25H27Cl2N3O7S |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | ethyl (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1c2cc([N+](=O)[O-])ccc2C(=O)N([C@H]2CCCC[C@@H]2NS(C)(=O)=O)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H27Cl2N3O7S/c1-3-37-25(32)22-18-13-15(30(33)34)9-11-16(18)24(31)29(23(22)17-10-8-14(26)12-19(17)27)21-7-5-4-6-20(21)28-38(2,35)36/h8-13,20-23,28H,3-7H2,1-2H3/t20-,21-,22+,23-/m0/s1 |
| InChIKey | GTTSFYJFINIYAD-GPJHCHHRSA-N |
| XLogP | 4.61 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|