C22H21Cl2N3O5 — CID 59478434
(3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 59478434) has the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 59478434 |
| Molecular Formula | C22H21Cl2N3O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (3R,4R)-2-[(1S,2S)-2-aminocyclohexyl]-3-(2,4-dichlorophenyl)-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | N[C@H]1CCCC[C@@H]1N1C(=O)c2ccc([N+](=O)[O-])cc2[C@@H](C(=O)O)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H21Cl2N3O5/c23-11-5-7-14(16(24)9-11)20-19(22(29)30)15-10-12(27(31)32)6-8-13(15)21(28)26(20)18-4-2-1-3-17(18)25/h5-10,17-20H,1-4,25H2,(H,29,30)/t17-,18-,19+,20-/m0/s1 |
| InChIKey | MYUICUGJRAPXPU-HAGHYFMRSA-N |
| XLogP | 4.54 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|