C26H25Cl2N3O5 — CID 59478530
(3S,4S)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478530) has the molecular formula C26H25Cl2N3O5 and a molecular weight of 530.41 g/mol. Its IUPAC name is (3S,4S)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478530 |
| Molecular Formula | C26H25Cl2N3O5 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (3S,4S)-3-(2,4-dichlorophenyl)-2-[(2S,3S)-1,3-dihydroxybutan-2-yl]-1-oxo-N-(pyridin-2-ylmethoxy)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | C[C@H](O)[C@H](CO)N1C(=O)c2ccccc2[C@H](C(=O)NOCc2ccccn2)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl2N3O5/c1-15(33)22(13-32)31-24(20-10-9-16(27)12-21(20)28)23(18-7-2-3-8-19(18)26(31)35)25(34)30-36-14-17-6-4-5-11-29-17/h2-12,15,22-24,32-33H,13-14H2,1H3,(H,30,34)/t15-,22-,23-,24+/m0/s1 |
| InChIKey | MSJIALSOGNQJSJ-HRHYPEDYSA-N |
| XLogP | 3.66 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|