C29H33Cl2N5O4S — CID 59478989
(3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[2-(3-methylpyrazol-1-yl)ethyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 59478989) has the molecular formula C29H33Cl2N5O4S and a molecular weight of 618.59 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[2-(3-methylpyrazol-1-yl)ethyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[2-(3-methylpyrazol-1-yl)ethyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59478989 |
| Molecular Formula | C29H33Cl2N5O4S |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-N-[2-(3-methylpyrazol-1-yl)ethyl]-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | Cc1ccn(CCNC(=O)[C@@H]2c3ccccc3C(=O)N([C@H]3CCCC[C@@H]3NS(C)(=O)=O)[C@H]2c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C29H33Cl2N5O4S/c1-18-13-15-35(33-18)16-14-32-28(37)26-20-7-3-4-8-21(20)29(38)36(27(26)22-12-11-19(30)17-23(22)31)25-10-6-5-9-24(25)34-41(2,39)40/h3-4,7-8,11-13,15,17,24-27,34H,5-6,9-10,14,16H2,1-2H3,(H,32,37)/t24-,25-,26+,27-/m0/s1 |
| InChIKey | GALHBRHWQSVUFM-NFGXINMFSA-N |
| XLogP | 4.46 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |