About 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium
2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium (PubChem CID 59479316) has the molecular formula C26H25N3O
and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium.
Molecular Properties
| Compound Name | 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium |
| PubChem CID | 59479316 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium |
| SMILES | CN1CCC(c2cc(-c3ccccc3)c3cc[n+]([O-])c(-c4ccccc4)c3n2)CC1 |
| InChI | InChI=1S/C26H25N3O/c1-28-15-12-20(13-16-28)24-18-23(19-8-4-2-5-9-19)22-14-17-29(30)26(25(22)27-24)21-10-6-3-7-11-21/h2-11,14,17-18,20H,12-13,15-16H2,1H3 |
| InChIKey | ZTITVTYUQGLJJO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium?
The IUPAC name of 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium (CID 59479316) is 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium.
What is the SMILES notation for 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium?
The canonical SMILES for 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium is CN1CCC(c2cc(-c3ccccc3)c3cc[n+]([O-])c(-c4ccccc4)c3n2)CC1.
What is the InChIKey of 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium?
The InChIKey is ZTITVTYUQGLJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O/c1-28-15-12-20(13-16-28)24-18-23(19-8-4-2-5-9-19)22-14-17-29(30)26(25(22)27-24)21-10-6-3-7-11-21/h2-11,14,17-18,20H,12-13,15-16H2,1H3.
What are the key properties of 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium?
2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium has a molecular weight of 395.51 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpiperidin-4-yl)-7-oxido-4,8-diphenyl-1,7-naphthyridin-7-ium is sourced from PubChem (CID 59479316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).