C26H28IN3O2 — CID 59479384
4-iodo-7-methoxy-1-(2-methoxyethyl)-2-(4-propan-2-ylphenyl)-5-(pyridin-3-ylmethyl)benzimidazole (PubChem CID 59479384) has the molecular formula C26H28IN3O2 and a molecular weight of 541.43 g/mol. Its IUPAC name is 4-iodo-7-methoxy-1-(2-methoxyethyl)-2-(4-propan-2-ylphenyl)-5-(pyridin-3-ylmethyl)benzimidazole.
| Compound Name | 4-iodo-7-methoxy-1-(2-methoxyethyl)-2-(4-propan-2-ylphenyl)-5-(pyridin-3-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 59479384 |
| Molecular Formula | C26H28IN3O2 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 4-iodo-7-methoxy-1-(2-methoxyethyl)-2-(4-propan-2-ylphenyl)-5-(pyridin-3-ylmethyl)benzimidazole |
| SMILES | COCCn1c(-c2ccc(C(C)C)cc2)nc2c(I)c(Cc3cccnc3)cc(OC)c21 |
| InChI | InChI=1S/C26H28IN3O2/c1-17(2)19-7-9-20(10-8-19)26-29-24-23(27)21(14-18-6-5-11-28-16-18)15-22(32-4)25(24)30(26)12-13-31-3/h5-11,15-17H,12-14H2,1-4H3 |
| InChIKey | WWJGSXJRDBEJOC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|