About [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol
[(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol (PubChem CID 59479700) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol |
| PubChem CID | 59479700 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol |
| SMILES | CC(C)(C)C[C@@H]1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C11H22O/c1-11(2,3)7-9-4-5-10(6-9)8-12/h9-10,12H,4-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | NFKIUNKBVPEJTA-NXEZZACHSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol?
The IUPAC name of [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol (CID 59479700) is [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol.
What is the SMILES notation for [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol?
The canonical SMILES for [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol is CC(C)(C)C[C@@H]1CC[C@@H](CO)C1.
What is the InChIKey of [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol?
The InChIKey is NFKIUNKBVPEJTA-NXEZZACHSA-N. The full InChI is InChI=1S/C11H22O/c1-11(2,3)7-9-4-5-10(6-9)8-12/h9-10,12H,4-8H2,1-3H3/t9-,10-/m1/s1.
What are the key properties of [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol?
[(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol has a molecular weight of 170.30 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3R)-3-(2,2-dimethylpropyl)cyclopentyl]methanol is sourced from PubChem (CID 59479700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).