C42H39NO4 — CID 59480241
4-[4-(18,18,19,19-tetramethyl-13-phenyl-5,7,12-trioxahexacyclo[15.8.0.02,10.04,8.011,16.020,25]pentacosa-1(17),2,4(8),9,11(16),14,20,22,24-nonaen-13-yl)phenyl]morpholine (PubChem CID 59480241) has the molecular formula C42H39NO4 and a molecular weight of 621.78 g/mol. Its IUPAC name is 4-[4-(18,18,19,19-tetramethyl-13-phenyl-5,7,12-trioxahexacyclo[15.8.0.02,10.04,8.011,16.020,25]pentacosa-1(17),2,4(8),9,11(16),14,20,22,24-nonaen-13-yl)phenyl]morpholine.
| Compound Name | 4-[4-(18,18,19,19-tetramethyl-13-phenyl-5,7,12-trioxahexacyclo[15.8.0.02,10.04,8.011,16.020,25]pentacosa-1(17),2,4(8),9,11(16),14,20,22,24-nonaen-13-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 59480241 |
| Molecular Formula | C42H39NO4 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 4-[4-(18,18,19,19-tetramethyl-13-phenyl-5,7,12-trioxahexacyclo[15.8.0.02,10.04,8.011,16.020,25]pentacosa-1(17),2,4(8),9,11(16),14,20,22,24-nonaen-13-yl)phenyl]morpholine |
| SMILES | CC1(C)c2ccccc2-c2c(c3c(c4cc5c(cc24)OCO5)OC(c2ccccc2)(c2ccc(N4CCOCC4)cc2)C=C3)C1(C)C |
| InChI | InChI=1S/C42H39NO4/c1-40(2)34-13-9-8-12-30(34)37-32-24-35-36(46-26-45-35)25-33(32)39-31(38(37)41(40,3)4)18-19-42(47-39,27-10-6-5-7-11-27)28-14-16-29(17-15-28)43-20-22-44-23-21-43/h5-19,24-25H,20-23,26H2,1-4H3 |
| InChIKey | IVWVUXRNSNMAGJ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|