About 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine
6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine (PubChem CID 59480282) has the molecular formula C14H20S2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine.
Molecular Properties
| Compound Name | 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine |
| PubChem CID | 59480282 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine |
| SMILES | CC(C)c1cc2c(cc1C(C)C)SCCS2 |
| InChI | InChI=1S/C14H20S2/c1-9(2)11-7-13-14(16-6-5-15-13)8-12(11)10(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | MCPDVEPHRKXCOX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine?
The IUPAC name of 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine (CID 59480282) is 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine.
What is the SMILES notation for 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine?
The canonical SMILES for 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine is CC(C)c1cc2c(cc1C(C)C)SCCS2.
What is the InChIKey of 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine?
The InChIKey is MCPDVEPHRKXCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S2/c1-9(2)11-7-13-14(16-6-5-15-13)8-12(11)10(3)4/h7-10H,5-6H2,1-4H3.
What are the key properties of 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine?
6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine has a molecular weight of 252.45 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-di(propan-2-yl)-2,3-dihydro-1,4-benzodithiine is sourced from PubChem (CID 59480282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).