C39H26N4 — CID 59480357
5-[6-[6-(3,5-diphenylphenyl)-2-pyridinyl]-2-pyridinyl]pyrido[4,3-b]indole (PubChem CID 59480357) has the molecular formula C39H26N4 and a molecular weight of 550.67 g/mol. Its IUPAC name is 5-[6-[6-(3,5-diphenylphenyl)-2-pyridinyl]-2-pyridinyl]pyrido[4,3-b]indole.
| Compound Name | 5-[6-[6-(3,5-diphenylphenyl)-2-pyridinyl]-2-pyridinyl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 59480357 |
| Molecular Formula | C39H26N4 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 5-[6-[6-(3,5-diphenylphenyl)-2-pyridinyl]-2-pyridinyl]pyrido[4,3-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cccc(-n5c6ccccc6c6cnccc65)n4)n3)c2)cc1 |
| InChI | InChI=1S/C39H26N4/c1-3-11-27(12-4-1)29-23-30(28-13-5-2-6-14-28)25-31(24-29)34-16-9-17-35(41-34)36-18-10-20-39(42-36)43-37-19-8-7-15-32(37)33-26-40-22-21-38(33)43/h1-26H |
| InChIKey | PEAJVQKTBQFSBQ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |