C36H44N2O2 — CID 59480571
5,12-di(octan-3-yl)quinolino[2,3-b]acridine-7,14-dione (PubChem CID 59480571) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 5,12-di(octan-3-yl)quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-di(octan-3-yl)quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 59480571 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 5,12-di(octan-3-yl)quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCCCCC(CC)n1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1ccccc1n3C(CC)CCCCC |
| InChI | InChI=1S/C36H44N2O2/c1-5-9-11-17-25(7-3)37-31-21-15-13-19-27(31)35(39)29-24-34-30(23-33(29)37)36(40)28-20-14-16-22-32(28)38(34)26(8-4)18-12-10-6-2/h13-16,19-26H,5-12,17-18H2,1-4H3 |
| InChIKey | ZYDQDNVWKHHCBX-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|