C10H15F3 — CID 59480781
2,2,3-trifluoro-1,4-dimethylbicyclo[2.2.2]octane (PubChem CID 59480781) has the molecular formula C10H15F3 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2,2,3-trifluoro-1,4-dimethylbicyclo[2.2.2]octane.
| Compound Name | 2,2,3-trifluoro-1,4-dimethylbicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59480781 |
| Molecular Formula | C10H15F3 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2,2,3-trifluoro-1,4-dimethylbicyclo[2.2.2]octane |
| SMILES | CC12CCC(C)(CC1)C(F)(F)C2F |
| InChI | InChI=1S/C10H15F3/c1-8-3-5-9(2,6-4-8)10(12,13)7(8)11/h7H,3-6H2,1-2H3 |
| InChIKey | VYNSWEGSIOQWPV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |