C17H16F6O2 — CID 59480864
(2,2,3,3-tetrafluoro-4-methyl-1-bicyclo[2.2.2]octanyl) 2,3-difluoro-4-methylbenzoate (PubChem CID 59480864) has the molecular formula C17H16F6O2 and a molecular weight of 366.30 g/mol. Its IUPAC name is (2,2,3,3-tetrafluoro-4-methyl-1-bicyclo[2.2.2]octanyl) 2,3-difluoro-4-methylbenzoate.
| Compound Name | (2,2,3,3-tetrafluoro-4-methyl-1-bicyclo[2.2.2]octanyl) 2,3-difluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 59480864 |
| Molecular Formula | C17H16F6O2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2,2,3,3-tetrafluoro-4-methyl-1-bicyclo[2.2.2]octanyl) 2,3-difluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC23CCC(C)(CC2)C(F)(F)C3(F)F)c(F)c1F |
| InChI | InChI=1S/C17H16F6O2/c1-9-3-4-10(12(19)11(9)18)13(24)25-15-7-5-14(2,6-8-15)16(20,21)17(15,22)23/h3-4H,5-8H2,1-2H3 |
| InChIKey | XFFZUBPXJXFOCV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|