About 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane
4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane (PubChem CID 59480883) has the molecular formula C21H32BrF3
and a molecular weight of 421.39 g/mol. Its IUPAC name is 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane |
| PubChem CID | 59480883 |
| Molecular Formula | C21H32BrF3 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane |
| SMILES | CC1CCC(C2CCC(C34CCC(Br)(CC3)C(F)C4(F)F)CC2)CC1 |
| InChI | InChI=1S/C21H32BrF3/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)19-10-12-20(22,13-11-19)18(23)21(19,24)25/h14-18H,2-13H2,1H3 |
| InChIKey | SZBAXCRWVDESRW-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane?
The IUPAC name of 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane (CID 59480883) is 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane.
What is the SMILES notation for 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane?
The canonical SMILES for 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane is CC1CCC(C2CCC(C34CCC(Br)(CC3)C(F)C4(F)F)CC2)CC1.
What is the InChIKey of 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane?
The InChIKey is SZBAXCRWVDESRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32BrF3/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)19-10-12-20(22,13-11-19)18(23)21(19,24)25/h14-18H,2-13H2,1H3.
What are the key properties of 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane?
4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane has a molecular weight of 421.39 g/mol, XLogP of 7.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,2,3-trifluoro-1-[4-(4-methylcyclohexyl)cyclohexyl]bicyclo[2.2.2]octane is sourced from PubChem (CID 59480883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).