C16H20F6O3S — CID 59480977
[2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate (PubChem CID 59480977) has the molecular formula C16H20F6O3S and a molecular weight of 406.39 g/mol. Its IUPAC name is [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate.
| Compound Name | [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59480977 |
| Molecular Formula | C16H20F6O3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2,3,3-trifluoro-4-(4-methylcyclohex-3-en-1-yl)-1-bicyclo[2.2.2]octanyl] trifluoromethanesulfonate |
| SMILES | CC1=CCC(C23CCC(OS(=O)(=O)C(F)(F)F)(CC2)C(F)C3(F)F)CC1 |
| InChI | InChI=1S/C16H20F6O3S/c1-10-2-4-11(5-3-10)13-6-8-14(9-7-13,12(17)15(13,18)19)25-26(23,24)16(20,21)22/h2,11-12H,3-9H2,1H3 |
| InChIKey | CHGIJYOOUJSRBT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|