C17H23BrF4 — CID 59480987
1-bromo-2,2,3,3-tetrafluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)bicyclo[2.2.2]octane (PubChem CID 59480987) has the molecular formula C17H23BrF4 and a molecular weight of 383.27 g/mol. Its IUPAC name is 1-bromo-2,2,3,3-tetrafluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)bicyclo[2.2.2]octane.
| Compound Name | 1-bromo-2,2,3,3-tetrafluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59480987 |
| Molecular Formula | C17H23BrF4 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-bromo-2,2,3,3-tetrafluoro-4-(4-methyl-1-bicyclo[2.2.2]octanyl)bicyclo[2.2.2]octane |
| SMILES | CC12CCC(C34CCC(Br)(CC3)C(F)(F)C4(F)F)(CC1)CC2 |
| InChI | InChI=1S/C17H23BrF4/c1-12-2-5-13(6-3-12,7-4-12)14-8-10-15(18,11-9-14)17(21,22)16(14,19)20/h2-11H2,1H3 |
| InChIKey | OPINUUIRQDFYQZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|