C17H26F4O2 — CID 59481103
2,2,3,3-tetrafluoro-1-(methoxymethoxy)-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane (PubChem CID 59481103) has the molecular formula C17H26F4O2 and a molecular weight of 338.39 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(methoxymethoxy)-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane.
| Compound Name | 2,2,3,3-tetrafluoro-1-(methoxymethoxy)-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59481103 |
| Molecular Formula | C17H26F4O2 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(methoxymethoxy)-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane |
| SMILES | COCOC12CCC(C3CCC(C)CC3)(CC1)C(F)(F)C2(F)F |
| InChI | InChI=1S/C17H26F4O2/c1-12-3-5-13(6-4-12)14-7-9-15(10-8-14,23-11-22-2)17(20,21)16(14,18)19/h12-13H,3-11H2,1-2H3 |
| InChIKey | LRLFKBJRKCMLPR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|