C15H21BrF4 — CID 59481104
1-bromo-2,2,3,3-tetrafluoro-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane (PubChem CID 59481104) has the molecular formula C15H21BrF4 and a molecular weight of 357.23 g/mol. Its IUPAC name is 1-bromo-2,2,3,3-tetrafluoro-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane.
| Compound Name | 1-bromo-2,2,3,3-tetrafluoro-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 59481104 |
| Molecular Formula | C15H21BrF4 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-bromo-2,2,3,3-tetrafluoro-4-(4-methylcyclohexyl)bicyclo[2.2.2]octane |
| SMILES | CC1CCC(C23CCC(Br)(CC2)C(F)(F)C3(F)F)CC1 |
| InChI | InChI=1S/C15H21BrF4/c1-10-2-4-11(5-3-10)12-6-8-13(16,9-7-12)15(19,20)14(12,17)18/h10-11H,2-9H2,1H3 |
| InChIKey | CWPKAHHHSDTTIZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|