About 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide
6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide (PubChem CID 59481909) has the molecular formula C14H19N3O5
and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide |
| PubChem CID | 59481909 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide |
| SMILES | CCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C14H19N3O5/c1-2-11(19)16-10(14(22)15-9-18)5-3-4-8-17-12(20)6-7-13(17)21/h6-7,9-10H,2-5,8H2,1H3,(H,16,19)(H,15,18,22) |
| InChIKey | AJOCPHSVZUXQGM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide (CID 59481909) is 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide is CCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide?
The InChIKey is AJOCPHSVZUXQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O5/c1-2-11(19)16-10(14(22)15-9-18)5-3-4-8-17-12(20)6-7-13(17)21/h6-7,9-10H,2-5,8H2,1H3,(H,16,19)(H,15,18,22).
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide?
6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide has a molecular weight of 309.32 g/mol, XLogP of -0.75, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)-N-formyl-2-(propanoylamino)hexanamide is sourced from PubChem (CID 59481909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).