C27H34N6O10 — CID 59481921
N,N'-bis[6-(2,5-dioxopyrrol-1-yl)-1-formamido-1-oxohexan-2-yl]pentanediamide (PubChem CID 59481921) has the molecular formula C27H34N6O10 and a molecular weight of 602.60 g/mol. Its IUPAC name is N,N'-bis[6-(2,5-dioxopyrrol-1-yl)-1-formamido-1-oxohexan-2-yl]pentanediamide.
| Compound Name | N,N'-bis[6-(2,5-dioxopyrrol-1-yl)-1-formamido-1-oxohexan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 59481921 |
| Molecular Formula | C27H34N6O10 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | N,N'-bis[6-(2,5-dioxopyrrol-1-yl)-1-formamido-1-oxohexan-2-yl]pentanediamide |
| SMILES | O=CNC(=O)C(CCCCN1C(=O)C=CC1=O)NC(=O)CCCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C27H34N6O10/c34-16-28-26(42)18(6-1-3-14-32-22(38)10-11-23(32)39)30-20(36)8-5-9-21(37)31-19(27(43)29-17-35)7-2-4-15-33-24(40)12-13-25(33)41/h10-13,16-19H,1-9,14-15H2,(H,30,36)(H,31,37)(H,28,34,42)(H,29,35,43) |
| InChIKey | DIHNILWFJGOYKX-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 225.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|