About N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide
N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide (PubChem CID 59481924) has the molecular formula C15H21N3O5
and a molecular weight of 323.35 g/mol. Its IUPAC name is N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide.
Molecular Properties
| Compound Name | N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide |
| PubChem CID | 59481924 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide |
| SMILES | CCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC(C)=O |
| InChI | InChI=1S/C15H21N3O5/c1-3-12(20)17-11(15(23)16-10(2)19)6-4-5-9-18-13(21)7-8-14(18)22/h7-8,11H,3-6,9H2,1-2H3,(H,17,20)(H,16,19,23) |
| InChIKey | HWKHFPAYNWUSJN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide?
The IUPAC name of N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide (CID 59481924) is N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide.
What is the SMILES notation for N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide?
The canonical SMILES for N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide is CCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC(C)=O.
What is the InChIKey of N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide?
The InChIKey is HWKHFPAYNWUSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O5/c1-3-12(20)17-11(15(23)16-10(2)19)6-4-5-9-18-13(21)7-8-14(18)22/h7-8,11H,3-6,9H2,1-2H3,(H,17,20)(H,16,19,23).
What are the key properties of N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide?
N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide has a molecular weight of 323.35 g/mol, XLogP of -0.36, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-6-(2,5-dioxopyrrol-1-yl)-2-(propanoylamino)hexanamide is sourced from PubChem (CID 59481924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).