C29H38N6O10 — CID 59481974
N,N'-bis[1-acetamido-6-(2,5-dioxopyrrol-1-yl)-1-oxohexan-2-yl]pentanediamide (PubChem CID 59481974) has the molecular formula C29H38N6O10 and a molecular weight of 630.66 g/mol. Its IUPAC name is N,N'-bis[1-acetamido-6-(2,5-dioxopyrrol-1-yl)-1-oxohexan-2-yl]pentanediamide.
| Compound Name | N,N'-bis[1-acetamido-6-(2,5-dioxopyrrol-1-yl)-1-oxohexan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 59481974 |
| Molecular Formula | C29H38N6O10 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | N,N'-bis[1-acetamido-6-(2,5-dioxopyrrol-1-yl)-1-oxohexan-2-yl]pentanediamide |
| SMILES | CC(=O)NC(=O)C(CCCCN1C(=O)C=CC1=O)NC(=O)CCCC(=O)NC(CCCCN1C(=O)C=CC1=O)C(=O)NC(C)=O |
| InChI | InChI=1S/C29H38N6O10/c1-18(36)30-28(44)20(8-3-5-16-34-24(40)12-13-25(34)41)32-22(38)10-7-11-23(39)33-21(29(45)31-19(2)37)9-4-6-17-35-26(42)14-15-27(35)43/h12-15,20-21H,3-11,16-17H2,1-2H3,(H,32,38)(H,33,39)(H,30,36,44)(H,31,37,45) |
| InChIKey | YNVRCOMUBJUFMC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 225.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|