About N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide
N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide (PubChem CID 59481976) has the molecular formula C16H22N4O6
and a molecular weight of 366.37 g/mol. Its IUPAC name is N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide.
Molecular Properties
| Compound Name | N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide |
| PubChem CID | 59481976 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide |
| SMILES | CCC(=O)NC(CC(=O)NCCCN1C(=O)C=CC1=O)C(=O)NC(C)=O |
| InChI | InChI=1S/C16H22N4O6/c1-3-12(22)19-11(16(26)18-10(2)21)9-13(23)17-7-4-8-20-14(24)5-6-15(20)25/h5-6,11H,3-4,7-9H2,1-2H3,(H,17,23)(H,19,22)(H,18,21,26) |
| InChIKey | UAGKPGSRZMVFED-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide?
The IUPAC name of N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide (CID 59481976) is N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide.
What is the SMILES notation for N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide?
The canonical SMILES for N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide is CCC(=O)NC(CC(=O)NCCCN1C(=O)C=CC1=O)C(=O)NC(C)=O.
What is the InChIKey of N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide?
The InChIKey is UAGKPGSRZMVFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O6/c1-3-12(22)19-11(16(26)18-10(2)21)9-13(23)17-7-4-8-20-14(24)5-6-15(20)25/h5-6,11H,3-4,7-9H2,1-2H3,(H,17,23)(H,19,22)(H,18,21,26).
What are the key properties of N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide?
N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide has a molecular weight of 366.37 g/mol, XLogP of -1.63, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-2-(propanoylamino)butanediamide is sourced from PubChem (CID 59481976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).