C18H21ClO7 — CID 59482093
(4S,6Z,9S,10S)-14-chloro-9,10,15,17-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[11.4.0]heptadeca-1(13),6,14,16-tetraene-2,8-dione (PubChem CID 59482093) has the molecular formula C18H21ClO7 and a molecular weight of 384.81 g/mol. Its IUPAC name is (4S,6Z,9S,10S)-14-chloro-9,10,15,17-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[11.4.0]heptadeca-1(13),6,14,16-tetraene-2,8-dione.
| Compound Name | (4S,6Z,9S,10S)-14-chloro-9,10,15,17-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[11.4.0]heptadeca-1(13),6,14,16-tetraene-2,8-dione |
|---|---|
| PubChem CID | 59482093 |
| Molecular Formula | C18H21ClO7 |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (4S,6Z,9S,10S)-14-chloro-9,10,15,17-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[11.4.0]heptadeca-1(13),6,14,16-tetraene-2,8-dione |
| SMILES | C/C1=C/C(=O)[C@@H](O)[C@@H](O)CCc2c(Cl)c(O)cc(O)c2C(=O)O[C@@H](C)C1 |
| InChI | InChI=1S/C18H21ClO7/c1-8-5-9(2)26-18(25)15-10(16(19)13(22)7-12(15)21)3-4-11(20)17(24)14(23)6-8/h6-7,9,11,17,20-22,24H,3-5H2,1-2H3/b8-6-/t9-,11-,17-/m0/s1 |
| InChIKey | AIKBGFUYDYPEBA-TWKLZFIVSA-N |
| XLogP | 1.87 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |