C19H23ClO7 — CID 59482125
(4S,6Z,9S,10S)-15-chloro-9,10,16,18-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,8-dione (PubChem CID 59482125) has the molecular formula C19H23ClO7 and a molecular weight of 398.84 g/mol. Its IUPAC name is (4S,6Z,9S,10S)-15-chloro-9,10,16,18-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,8-dione.
| Compound Name | (4S,6Z,9S,10S)-15-chloro-9,10,16,18-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,8-dione |
|---|---|
| PubChem CID | 59482125 |
| Molecular Formula | C19H23ClO7 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (4S,6Z,9S,10S)-15-chloro-9,10,16,18-tetrahydroxy-4,6-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,8-dione |
| SMILES | C/C1=C/C(=O)[C@@H](O)[C@@H](O)CCCc2c(Cl)c(O)cc(O)c2C(=O)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H23ClO7/c1-9-6-10(2)27-19(26)16-11(17(20)14(23)8-13(16)22)4-3-5-12(21)18(25)15(24)7-9/h7-8,10,12,18,21-23,25H,3-6H2,1-2H3/b9-7-/t10-,12-,18-/m0/s1 |
| InChIKey | QIEIAQVUDCXSPE-KGJMLPOVSA-N |
| XLogP | 2.26 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |