C32H47FO5Si — CID 59482136
tert-butyl-[(3Z,6E)-6-fluoro-5,9-bis[(4-methoxyphenyl)methoxy]-7-methylnona-3,6-dienoxy]-dimethylsilane (PubChem CID 59482136) has the molecular formula C32H47FO5Si and a molecular weight of 558.81 g/mol. Its IUPAC name is tert-butyl-[(3Z,6E)-6-fluoro-5,9-bis[(4-methoxyphenyl)methoxy]-7-methylnona-3,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3Z,6E)-6-fluoro-5,9-bis[(4-methoxyphenyl)methoxy]-7-methylnona-3,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59482136 |
| Molecular Formula | C32H47FO5Si |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | tert-butyl-[(3Z,6E)-6-fluoro-5,9-bis[(4-methoxyphenyl)methoxy]-7-methylnona-3,6-dienoxy]-dimethylsilane |
| SMILES | COc1ccc(COCC/C(C)=C(/F)C(/C=C\CCO[Si](C)(C)C(C)(C)C)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H47FO5Si/c1-25(20-22-36-23-26-12-16-28(34-5)17-13-26)31(33)30(37-24-27-14-18-29(35-6)19-15-27)11-9-10-21-38-39(7,8)32(2,3)4/h9,11-19,30H,10,20-24H2,1-8H3/b11-9-,31-25+ |
| InChIKey | BSRJQTZXWZIOFO-GACUKYEXSA-N |
| XLogP | 8.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|