C44H78N16O4 — CID 59482393
CID 59482393 (PubChem CID 59482393) has the molecular formula C44H78N16O4 and a molecular weight of 895.22 g/mol.
| Compound Name | CID 59482393 |
|---|---|
| PubChem CID | 59482393 |
| Molecular Formula | C44H78N16O4 |
| Molecular Weight | 895.22 g/mol |
| Exact Mass | 894.64 |
| IUPAC Name | — |
| SMILES | CN(c1nc(NC2CC(C)(C)N([O])C(C)(C)C2)nc(NC2CC(C)(C)N([O])C(C)(C)C2)n1)N(C)c1nc(NC2CC(C)(C)N([O])C(C)(C)C2)nc(NC2CC(C)(C)N([O])C(C)(C)C2)n1 |
| InChI | InChI=1S/C44H78N16O4/c1-37(2)19-27(20-38(3,4)57(37)61)45-31-49-32(46-28-21-39(5,6)58(62)40(7,8)22-28)52-35(51-31)55(17)56(18)36-53-33(47-29-23-41(9,10)59(63)42(11,12)24-29)50-34(54-36)48-30-25-43(13,14)60(64)44(15,16)26-30/h27-30H,19-26H2,1-18H3,(H2,45,46,49,51,52)(H2,47,48,50,53,54) |
| InChIKey | CKLPGEOEFNBPLA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 224.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.22 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|