About CID 59482502
CID 59482502 (PubChem CID 59482502) has the molecular formula C27H39N5O5
and a molecular weight of 513.64 g/mol.
Molecular Properties
| Compound Name | CID 59482502 |
| PubChem CID | 59482502 |
| Molecular Formula | C27H39N5O5 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(Oc2nc(Oc3ccccc3)nc(OC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C27H39N5O5/c1-24(2)14-19(15-25(3,4)31(24)33)36-22-28-21(35-18-12-10-9-11-13-18)29-23(30-22)37-20-16-26(5,6)32(34)27(7,8)17-20/h9-13,19-20H,14-17H2,1-8H3 |
| InChIKey | MFPIUVMRSGCLTB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 59482502 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59482502?
The IUPAC name of CID 59482502 (CID 59482502) is not available.
What is the SMILES notation for CID 59482502?
The canonical SMILES for CID 59482502 is CC1(C)CC(Oc2nc(Oc3ccccc3)nc(OC3CC(C)(C)N([O])C(C)(C)C3)n2)CC(C)(C)N1[O].
What is the InChIKey of CID 59482502?
The InChIKey is MFPIUVMRSGCLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H39N5O5/c1-24(2)14-19(15-25(3,4)31(24)33)36-22-28-21(35-18-12-10-9-11-13-18)29-23(30-22)37-20-16-26(5,6)32(34)27(7,8)17-20/h9-13,19-20H,14-17H2,1-8H3.
What are the key properties of CID 59482502?
CID 59482502 has a molecular weight of 513.64 g/mol, XLogP of 5.16, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59482502 is sourced from PubChem (CID 59482502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).