C14H16F8O6S — CID 59482631
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[3-(2-methylprop-2-enoyloxy)cyclohexyl]ethoxy]ethanesulfonic acid (PubChem CID 59482631) has the molecular formula C14H16F8O6S and a molecular weight of 464.33 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[3-(2-methylprop-2-enoyloxy)cyclohexyl]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[3-(2-methylprop-2-enoyloxy)cyclohexyl]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 59482631 |
| Molecular Formula | C14H16F8O6S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[3-(2-methylprop-2-enoyloxy)cyclohexyl]ethoxy]ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC1CCCC(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C14H16F8O6S/c1-7(2)10(23)27-9-5-3-4-8(6-9)11(15,16)12(17,18)28-13(19,20)14(21,22)29(24,25)26/h8-9H,1,3-6H2,2H3,(H,24,25,26) |
| InChIKey | QEABRXMUHPEOTD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|