C30H30N3OS+ — CID 59482918
1-benzyl-7-methoxy-N,N-dimethyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-amine (PubChem CID 59482918) has the molecular formula C30H30N3OS+ and a molecular weight of 480.66 g/mol. Its IUPAC name is 1-benzyl-7-methoxy-N,N-dimethyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-amine.
| Compound Name | 1-benzyl-7-methoxy-N,N-dimethyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 59482918 |
| Molecular Formula | C30H30N3OS+ |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-benzyl-7-methoxy-N,N-dimethyl-4-[(Z)-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidenemethyl]quinolin-1-ium-2-amine |
| SMILES | COc1ccc2c(/C=C3\Sc4cccc5c4N3CCC5)cc(N(C)C)[n+](Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C30H30N3OS/c1-31(2)28-17-23(18-29-32-16-8-12-22-11-7-13-27(35-29)30(22)32)25-15-14-24(34-3)19-26(25)33(28)20-21-9-5-4-6-10-21/h4-7,9-11,13-15,17-19H,8,12,16,20H2,1-3H3/q+1 |
| InChIKey | LBMIVQKIVXBIOH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|