C28H24ClN2OS+ — CID 59482926
(2Z)-2-[(1-benzyl-2-chloro-7-methoxyquinolin-1-ium-4-yl)methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (PubChem CID 59482926) has the molecular formula C28H24ClN2OS+ and a molecular weight of 472.03 g/mol. Its IUPAC name is (2Z)-2-[(1-benzyl-2-chloro-7-methoxyquinolin-1-ium-4-yl)methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
| Compound Name | (2Z)-2-[(1-benzyl-2-chloro-7-methoxyquinolin-1-ium-4-yl)methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
|---|---|
| PubChem CID | 59482926 |
| Molecular Formula | C28H24ClN2OS+ |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (2Z)-2-[(1-benzyl-2-chloro-7-methoxyquinolin-1-ium-4-yl)methylidene]-3-thia-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene |
| SMILES | COc1ccc2c(/C=C3\Sc4cccc5c4N3CCC5)cc(Cl)[n+](Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C28H24ClN2OS/c1-32-22-12-13-23-21(15-26(29)31(24(23)17-22)18-19-7-3-2-4-8-19)16-27-30-14-6-10-20-9-5-11-25(33-27)28(20)30/h2-5,7-9,11-13,15-17H,6,10,14,18H2,1H3/q+1 |
| InChIKey | DDLKNKMTDMJYBW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|